C27H16BrN5O2 — CID 126315081
2-[3-[[2-(5-bromo-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]acetonitrile (PubChem CID 126315081) has the molecular formula C27H16BrN5O2 and a molecular weight of 522.36 g/mol. Its IUPAC name is 2-[3-[[2-(5-bromo-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]acetonitrile.
| Compound Name | 2-[3-[[2-(5-bromo-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 126315081 |
| Molecular Formula | C27H16BrN5O2 |
| Molecular Weight | 522.36 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | 2-[3-[[2-(5-bromo-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]acetonitrile |
| SMILES | N#CCn1cc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C27H16BrN5O2/c28-19-9-10-24-17(13-19)14-25(35-24)26-31-22-7-3-1-6-21(22)27(34)33(26)30-15-18-16-32(12-11-29)23-8-4-2-5-20(18)23/h1-10,13-16H,12H2 |
| InChIKey | ZQINEHDGKOFNFD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 89.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.36 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|