C23H13BrN4O5 — CID 137090025
2-(5-bromo-1-benzofuran-2-yl)-3-[(2-hydroxy-5-nitrophenyl)methylideneamino]quinazolin-4-one (PubChem CID 137090025) has the molecular formula C23H13BrN4O5 and a molecular weight of 505.28 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[(2-hydroxy-5-nitrophenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[(2-hydroxy-5-nitrophenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 137090025 |
| Molecular Formula | C23H13BrN4O5 |
| Molecular Weight | 505.28 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[(2-hydroxy-5-nitrophenyl)methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3cc(Br)ccc3o2)n1N=Cc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C23H13BrN4O5/c24-15-5-8-20-13(9-15)11-21(33-20)22-26-18-4-2-1-3-17(18)23(30)27(22)25-12-14-10-16(28(31)32)6-7-19(14)29/h1-12,29H |
| InChIKey | ADXUCAVEYIFMEN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|