C28H19N5O3 — CID 126294842
2-[3-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]acetonitrile (PubChem CID 126294842) has the molecular formula C28H19N5O3 and a molecular weight of 473.49 g/mol. Its IUPAC name is 2-[3-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]acetonitrile.
| Compound Name | 2-[3-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 126294842 |
| Molecular Formula | C28H19N5O3 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 2-[3-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]acetonitrile |
| SMILES | COc1cccc2oc(-c3nc4ccccc4c(=O)n3N=Cc3cn(CC#N)c4ccccc34)cc12 |
| InChI | InChI=1S/C28H19N5O3/c1-35-24-11-6-12-25-21(24)15-26(36-25)27-31-22-9-4-2-8-20(22)28(34)33(27)30-16-18-17-32(14-13-29)23-10-5-3-7-19(18)23/h2-12,15-17H,14H2,1H3 |
| InChIKey | BLDKMQGQNALKTE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|