C31H26N4O5 — CID 126303262
ethyl (2R)-2-[3-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]propanoate (PubChem CID 126303262) has the molecular formula C31H26N4O5 and a molecular weight of 534.57 g/mol. Its IUPAC name is ethyl (2R)-2-[3-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]propanoate.
| Compound Name | ethyl (2R)-2-[3-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]propanoate |
|---|---|
| PubChem CID | 126303262 |
| Molecular Formula | C31H26N4O5 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | ethyl (2R)-2-[3-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)n1cc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C31H26N4O5/c1-4-39-31(37)19(2)34-18-20(21-10-6-8-13-25(21)34)17-32-35-29(33-24-12-7-5-11-22(24)30(35)36)28-16-23-26(38-3)14-9-15-27(23)40-28/h5-19H,4H2,1-3H3/t19-/m1/s1 |
| InChIKey | VXQBCPOCMGIISY-LJQANCHMSA-N |
| XLogP | 5.78 |
| TPSA | 100.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|