C29H24N4O8 — CID 126287988
ethyl (2R)-2-[4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]propanoate (PubChem CID 126287988) has the molecular formula C29H24N4O8 and a molecular weight of 556.53 g/mol. Its IUPAC name is ethyl (2R)-2-[4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 126287988 |
| Molecular Formula | C29H24N4O8 |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | ethyl (2R)-2-[4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1ccc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H24N4O8/c1-4-39-29(35)17(2)40-25-13-12-18(14-22(25)33(36)37)16-30-32-27(31-21-9-6-5-8-19(21)28(32)34)26-15-20-23(38-3)10-7-11-24(20)41-26/h5-17H,4H2,1-3H3/t17-/m1/s1 |
| InChIKey | ONURYAAVWWJENU-QGZVFWFLSA-N |
| XLogP | 4.94 |
| TPSA | 148.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|