C29H26N4O7 — CID 126288556
3-[(3-ethoxy-5-nitro-4-propan-2-yloxyphenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126288556) has the molecular formula C29H26N4O7 and a molecular weight of 542.55 g/mol. Its IUPAC name is 3-[(3-ethoxy-5-nitro-4-propan-2-yloxyphenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[(3-ethoxy-5-nitro-4-propan-2-yloxyphenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126288556 |
| Molecular Formula | C29H26N4O7 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 3-[(3-ethoxy-5-nitro-4-propan-2-yloxyphenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OC(C)C |
| InChI | InChI=1S/C29H26N4O7/c1-5-38-25-14-18(13-22(33(35)36)27(25)39-17(2)3)16-30-32-28(31-21-10-7-6-9-19(21)29(32)34)26-15-20-23(37-4)11-8-12-24(20)40-26/h6-17H,5H2,1-4H3 |
| InChIKey | GQUXIJOJXCBBDP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 131.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|