C34H26N4O9 — CID 126313800
3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126313800) has the molecular formula C34H26N4O9 and a molecular weight of 634.60 g/mol. Its IUPAC name is 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126313800 |
| Molecular Formula | C34H26N4O9 |
| Molecular Weight | 634.60 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C34H26N4O9/c1-3-43-30-15-21(13-25(38(40)41)32(30)44-18-20-11-12-28-29(14-20)46-19-45-28)17-35-37-33(36-24-8-5-4-7-22(24)34(37)39)31-16-23-26(42-2)9-6-10-27(23)47-31/h4-17H,3,18-19H2,1-2H3 |
| InChIKey | UJRIWHCSMSZFTH-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 149.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.60 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|