C33H25FN4O7 — CID 126289362
3-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126289362) has the molecular formula C33H25FN4O7 and a molecular weight of 608.58 g/mol. Its IUPAC name is 3-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126289362 |
| Molecular Formula | C33H25FN4O7 |
| Molecular Weight | 608.58 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | 3-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCc1ccccc1F |
| InChI | InChI=1S/C33H25FN4O7/c1-3-43-29-16-20(15-26(38(40)41)31(29)44-19-21-9-4-6-11-24(21)34)18-35-37-32(36-25-12-7-5-10-22(25)33(37)39)30-17-23-27(42-2)13-8-14-28(23)45-30/h4-18H,3,19H2,1-2H3 |
| InChIKey | ONJXDWAQPSVBKT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 131.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|