C28H24N4O7 — CID 126285988
3-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126285988) has the molecular formula C28H24N4O7 and a molecular weight of 528.52 g/mol. Its IUPAC name is 3-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126285988 |
| Molecular Formula | C28H24N4O7 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 3-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C28H24N4O7/c1-4-37-24-14-17(13-21(32(34)35)26(24)38-5-2)16-29-31-27(30-20-10-7-6-9-18(20)28(31)33)25-15-19-22(36-3)11-8-12-23(19)39-25/h6-16H,4-5H2,1-3H3 |
| InChIKey | IPDQCCHHRVEHOH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 131.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|