C32H23N5O9 — CID 126302988
2-(4-methoxy-1-benzofuran-2-yl)-3-[[3-methoxy-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126302988) has the molecular formula C32H23N5O9 and a molecular weight of 621.56 g/mol. Its IUPAC name is 2-(4-methoxy-1-benzofuran-2-yl)-3-[[3-methoxy-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(4-methoxy-1-benzofuran-2-yl)-3-[[3-methoxy-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126302988 |
| Molecular Formula | C32H23N5O9 |
| Molecular Weight | 621.56 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | 2-(4-methoxy-1-benzofuran-2-yl)-3-[[3-methoxy-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H23N5O9/c1-43-26-8-5-9-27-23(26)16-29(46-27)31-34-24-7-4-3-6-22(24)32(38)35(31)33-17-20-14-25(37(41)42)30(28(15-20)44-2)45-18-19-10-12-21(13-11-19)36(39)40/h3-17H,18H2,1-2H3 |
| InChIKey | RRINEMMQJSHYOI-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 174.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|