C33H24Cl2N4O7 — CID 126309614
3-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126309614) has the molecular formula C33H24Cl2N4O7 and a molecular weight of 659.48 g/mol. Its IUPAC name is 3-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126309614 |
| Molecular Formula | C33H24Cl2N4O7 |
| Molecular Weight | 659.48 g/mol |
| Exact Mass | 658.10 |
| IUPAC Name | 3-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C33H24Cl2N4O7/c1-3-44-29-15-20(14-26(39(41)42)31(29)45-18-19-11-12-23(34)24(35)13-19)17-36-38-32(37-25-8-5-4-7-21(25)33(38)40)30-16-22-27(43-2)9-6-10-28(22)46-30/h4-17H,3,18H2,1-2H3 |
| InChIKey | HLARBWALAQHMPL-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 131.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.48 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|