C33H23N5O7 — CID 126307755
2-[[2-methoxy-4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]methyl]benzonitrile (PubChem CID 126307755) has the molecular formula C33H23N5O7 and a molecular weight of 601.58 g/mol. Its IUPAC name is 2-[[2-methoxy-4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-methoxy-4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126307755 |
| Molecular Formula | C33H23N5O7 |
| Molecular Weight | 601.58 g/mol |
| Exact Mass | 601.16 |
| IUPAC Name | 2-[[2-methoxy-4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]methyl]benzonitrile |
| SMILES | COc1cc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCc1ccccc1C#N |
| InChI | InChI=1S/C33H23N5O7/c1-42-27-12-7-13-28-24(27)16-30(45-28)32-36-25-11-6-5-10-23(25)33(39)37(32)35-18-20-14-26(38(40)41)31(29(15-20)43-2)44-19-22-9-4-3-8-21(22)17-34/h3-16,18H,19H2,1-2H3 |
| InChIKey | CRQBYHRULREDNX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 155.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|