C32H21ClN4O8 — CID 126294111
3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-chloro-3-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126294111) has the molecular formula C32H21ClN4O8 and a molecular weight of 624.99 g/mol. Its IUPAC name is 3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-chloro-3-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-chloro-3-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126294111 |
| Molecular Formula | C32H21ClN4O8 |
| Molecular Weight | 624.99 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | 3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-chloro-3-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | COc1cccc2oc(-c3nc4ccccc4c(=O)n3N=Cc3cc(Cl)cc([N+](=O)[O-])c3OCc3ccc4c(c3)OCO4)cc12 |
| InChI | InChI=1S/C32H21ClN4O8/c1-41-25-7-4-8-26-22(25)14-29(45-26)31-35-23-6-3-2-5-21(23)32(38)36(31)34-15-19-12-20(33)13-24(37(39)40)30(19)42-16-18-9-10-27-28(11-18)44-17-43-27/h2-15H,16-17H2,1H3 |
| InChIKey | BCWIUMDQVFTFGU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 140.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.99 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|