C29H17ClN6O8 — CID 126296865
3-[[5-chloro-3-nitro-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126296865) has the molecular formula C29H17ClN6O8 and a molecular weight of 612.94 g/mol. Its IUPAC name is 3-[[5-chloro-3-nitro-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[5-chloro-3-nitro-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126296865 |
| Molecular Formula | C29H17ClN6O8 |
| Molecular Weight | 612.94 g/mol |
| Exact Mass | 612.08 |
| IUPAC Name | 3-[[5-chloro-3-nitro-2-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | COc1cccc2oc(-c3nc4ccccc4c(=O)n3N=Cc3cc(Cl)cc([N+](=O)[O-])c3Oc3ccc([N+](=O)[O-])cn3)cc12 |
| InChI | InChI=1S/C29H17ClN6O8/c1-42-23-7-4-8-24-20(23)13-25(43-24)28-33-21-6-3-2-5-19(21)29(37)34(28)32-14-16-11-17(30)12-22(36(40)41)27(16)44-26-10-9-18(15-31-26)35(38)39/h2-15H,1H3 |
| InChIKey | MWCAICGUYQZVAQ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 178.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.94 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|