C34H27N5O7 — CID 126289272
3-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126289272) has the molecular formula C34H27N5O7 and a molecular weight of 617.62 g/mol. Its IUPAC name is 3-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126289272 |
| Molecular Formula | C34H27N5O7 |
| Molecular Weight | 617.62 g/mol |
| Exact Mass | 617.19 |
| IUPAC Name | 3-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)cc(OCC)c1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C34H27N5O7/c1-4-9-22-16-21(17-29(44-5-2)32(22)46-31-15-14-23(20-35-31)39(41)42)19-36-38-33(37-26-11-7-6-10-24(26)34(38)40)30-18-25-27(43-3)12-8-13-28(25)45-30/h4,6-8,10-20H,1,5,9H2,2-3H3 |
| InChIKey | RARUECBYJMNBRT-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 144.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|