C31H31N5O5 — CID 126302015
2-cyclohexyl-3-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126302015) has the molecular formula C31H31N5O5 and a molecular weight of 553.62 g/mol. Its IUPAC name is 2-cyclohexyl-3-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126302015 |
| Molecular Formula | C31H31N5O5 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 2-cyclohexyl-3-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc(OCC)c1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C31H31N5O5/c1-3-10-23-17-21(18-27(40-4-2)29(23)41-28-16-15-24(20-32-28)36(38)39)19-33-35-30(22-11-6-5-7-12-22)34-26-14-9-8-13-25(26)31(35)37/h3,8-9,13-20,22H,1,4-7,10-12H2,2H3 |
| InChIKey | RQSTUUYOZCPJIE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 121.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|