C28H25Br2N5O5 — CID 126310182
2-cyclohexyl-3-[[2,3-dibromo-5-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126310182) has the molecular formula C28H25Br2N5O5 and a molecular weight of 671.35 g/mol. Its IUPAC name is 2-cyclohexyl-3-[[2,3-dibromo-5-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[[2,3-dibromo-5-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126310182 |
| Molecular Formula | C28H25Br2N5O5 |
| Molecular Weight | 671.35 g/mol |
| Exact Mass | 669.02 |
| IUPAC Name | 2-cyclohexyl-3-[[2,3-dibromo-5-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)c(Br)c(Br)c1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C28H25Br2N5O5/c1-2-39-22-14-18(24(29)25(30)26(22)40-23-13-12-19(16-31-23)35(37)38)15-32-34-27(17-8-4-3-5-9-17)33-21-11-7-6-10-20(21)28(34)36/h6-7,10-17H,2-5,8-9H2,1H3 |
| InChIKey | IZGYWGUHLZUMGV-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 121.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.35 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|