C26H21BrClN5O4 — CID 126301359
3-[[3-bromo-5-chloro-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126301359) has the molecular formula C26H21BrClN5O4 and a molecular weight of 582.84 g/mol. Its IUPAC name is 3-[[3-bromo-5-chloro-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 3-[[3-bromo-5-chloro-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126301359 |
| Molecular Formula | C26H21BrClN5O4 |
| Molecular Weight | 582.84 g/mol |
| Exact Mass | 581.05 |
| IUPAC Name | 3-[[3-bromo-5-chloro-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C2CCCCC2)n1N=Cc1cc(Cl)c(Oc2ccc([N+](=O)[O-])cn2)c(Br)c1 |
| InChI | InChI=1S/C26H21BrClN5O4/c27-20-12-16(13-21(28)24(20)37-23-11-10-18(15-29-23)33(35)36)14-30-32-25(17-6-2-1-3-7-17)31-22-9-5-4-8-19(22)26(32)34/h4-5,8-15,17H,1-3,6-7H2 |
| InChIKey | NQNAZBGHVHHXQE-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 112.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.84 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|