C32H31Cl2N3O3 — CID 126298473
2-cyclohexyl-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126298473) has the molecular formula C32H31Cl2N3O3 and a molecular weight of 576.52 g/mol. Its IUPAC name is 2-cyclohexyl-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126298473 |
| Molecular Formula | C32H31Cl2N3O3 |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | 2-cyclohexyl-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc(OC)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C32H31Cl2N3O3/c1-3-9-24-16-22(18-29(39-2)30(24)40-20-21-14-15-26(33)27(34)17-21)19-35-37-31(23-10-5-4-6-11-23)36-28-13-8-7-12-25(28)32(37)38/h3,7-8,12-19,23H,1,4-6,9-11,20H2,2H3 |
| InChIKey | DLVSQODDUXFQAT-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|