C32H32FN3O3 — CID 126309865
2-cyclohexyl-3-[[4-[(3-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126309865) has the molecular formula C32H32FN3O3 and a molecular weight of 525.62 g/mol. Its IUPAC name is 2-cyclohexyl-3-[[4-[(3-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[[4-[(3-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126309865 |
| Molecular Formula | C32H32FN3O3 |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 2-cyclohexyl-3-[[4-[(3-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]quinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc(OC)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C32H32FN3O3/c1-3-10-25-17-23(19-29(38-2)30(25)39-21-22-11-9-14-26(33)18-22)20-34-36-31(24-12-5-4-6-13-24)35-28-16-8-7-15-27(28)32(36)37/h3,7-9,11,14-20,24H,1,4-6,10,12-13,21H2,2H3 |
| InChIKey | JIELMNHWLDUIER-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|