C31H31FN4O5 — CID 126313700
2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dimethoxyphenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 126313700) has the molecular formula C31H31FN4O5 and a molecular weight of 558.61 g/mol. Its IUPAC name is 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dimethoxyphenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dimethoxyphenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126313700 |
| Molecular Formula | C31H31FN4O5 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-dimethoxyphenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc(OC)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C31H31FN4O5/c1-39-26-16-20(17-27(40-2)29(26)41-19-28(37)34-23-14-12-22(32)13-15-23)18-33-36-30(21-8-4-3-5-9-21)35-25-11-7-6-10-24(25)31(36)38/h6-7,10-18,21H,3-5,8-9,19H2,1-2H3,(H,34,37) |
| InChIKey | VKDWMWPJIGZUNC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|