C31H31ClN4O4 — CID 126315001
2-[2-chloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126315001) has the molecular formula C31H31ClN4O4 and a molecular weight of 559.07 g/mol. Its IUPAC name is 2-[2-chloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126315001 |
| Molecular Formula | C31H31ClN4O4 |
| Molecular Weight | 559.07 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 2-[2-chloro-4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc(Cl)c1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C31H31ClN4O4/c1-20-10-6-8-14-25(20)34-28(37)19-40-29-24(32)16-21(17-27(29)39-2)18-33-36-30(22-11-4-3-5-12-22)35-26-15-9-7-13-23(26)31(36)38/h6-10,13-18,22H,3-5,11-12,19H2,1-2H3,(H,34,37) |
| InChIKey | ZHLSETUHUWRWLS-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.07 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|