C27H22BrCl2N3O3 — CID 126288279
6-bromo-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126288279) has the molecular formula C27H22BrCl2N3O3 and a molecular weight of 587.30 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126288279 |
| Molecular Formula | C27H22BrCl2N3O3 |
| Molecular Weight | 587.30 g/mol |
| Exact Mass | 585.02 |
| IUPAC Name | 6-bromo-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)cc(OC)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H22BrCl2N3O3/c1-4-5-19-10-18(12-25(35-3)26(19)36-15-17-6-8-22(29)23(30)11-17)14-31-33-16(2)32-24-9-7-20(28)13-21(24)27(33)34/h4,6-14H,1,5,15H2,2-3H3 |
| InChIKey | OUKSPSYWKDRDKG-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.30 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|