C24H17BrCl2IN3O3 — CID 126300036
6-bromo-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126300036) has the molecular formula C24H17BrCl2IN3O3 and a molecular weight of 673.13 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126300036 |
| Molecular Formula | C24H17BrCl2IN3O3 |
| Molecular Weight | 673.13 g/mol |
| Exact Mass | 670.89 |
| IUPAC Name | 6-bromo-3-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)cc(I)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H17BrCl2IN3O3/c1-13-30-21-6-4-16(25)10-17(21)24(32)31(13)29-11-15-8-20(28)23(22(9-15)33-2)34-12-14-3-5-18(26)19(27)7-14/h3-11H,12H2,1-2H3 |
| InChIKey | MEQAHSUIDFNZSM-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.13 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|