C23H14BrCl2I2N3O2 — CID 126289190
6-bromo-3-[[4-[(3,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126289190) has the molecular formula C23H14BrCl2I2N3O2 and a molecular weight of 769.00 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(3,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(3,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126289190 |
| Molecular Formula | C23H14BrCl2I2N3O2 |
| Molecular Weight | 769.00 g/mol |
| Exact Mass | 766.77 |
| IUPAC Name | 6-bromo-3-[[4-[(3,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(I)c(OCc2ccc(Cl)c(Cl)c2)c(I)c1 |
| InChI | InChI=1S/C23H14BrCl2I2N3O2/c1-12-30-21-5-3-15(24)9-16(21)23(32)31(12)29-10-14-7-19(27)22(20(28)8-14)33-11-13-2-4-17(25)18(26)6-13/h2-10H,11H2,1H3 |
| InChIKey | IGBLFTDIKYAMOS-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.00 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|