C16H10BrI2N3O2 — CID 137125747
6-bromo-3-[(4-hydroxy-3,5-diiodophenyl)methylideneamino]-2-methylquinazolin-4-one (PubChem CID 137125747) has the molecular formula C16H10BrI2N3O2 and a molecular weight of 609.99 g/mol. Its IUPAC name is 6-bromo-3-[(4-hydroxy-3,5-diiodophenyl)methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(4-hydroxy-3,5-diiodophenyl)methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 137125747 |
| Molecular Formula | C16H10BrI2N3O2 |
| Molecular Weight | 609.99 g/mol |
| Exact Mass | 608.80 |
| IUPAC Name | 6-bromo-3-[(4-hydroxy-3,5-diiodophenyl)methylideneamino]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C16H10BrI2N3O2/c1-8-21-14-3-2-10(17)6-11(14)16(24)22(8)20-7-9-4-12(18)15(23)13(19)5-9/h2-7,23H,1H3 |
| InChIKey | JSFKDXBAOFMJAS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.99 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|