C28H26BrN3O3 — CID 126283774
6-bromo-3-[[3-methoxy-4-[(3-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126283774) has the molecular formula C28H26BrN3O3 and a molecular weight of 532.44 g/mol. Its IUPAC name is 6-bromo-3-[[3-methoxy-4-[(3-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[3-methoxy-4-[(3-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126283774 |
| Molecular Formula | C28H26BrN3O3 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 6-bromo-3-[[3-methoxy-4-[(3-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)cc(OC)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C28H26BrN3O3/c1-5-7-22-13-21(14-26(34-4)27(22)35-17-20-9-6-8-18(2)12-20)16-30-32-19(3)31-25-11-10-23(29)15-24(25)28(32)33/h5-6,8-16H,1,7,17H2,2-4H3 |
| InChIKey | BIDVHFNZZHAJFT-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|