C28H24N4O6 — CID 126292853
3-[[4-[(2S)-butan-2-yl]oxy-3-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126292853) has the molecular formula C28H24N4O6 and a molecular weight of 512.52 g/mol. Its IUPAC name is 3-[[4-[(2S)-butan-2-yl]oxy-3-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[4-[(2S)-butan-2-yl]oxy-3-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126292853 |
| Molecular Formula | C28H24N4O6 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 3-[[4-[(2S)-butan-2-yl]oxy-3-nitrophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | CC[C@H](C)Oc1ccc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H24N4O6/c1-4-17(2)37-25-13-12-18(14-22(25)32(34)35)16-29-31-27(30-21-9-6-5-8-19(21)28(31)33)26-15-20-23(36-3)10-7-11-24(20)38-26/h5-17H,4H2,1-3H3/t17-/m0/s1 |
| InChIKey | ZLDOWSCOZUBOMQ-KRWDZBQOSA-N |
| XLogP | 5.79 |
| TPSA | 121.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|