C32H23N5O7 — CID 126301338
2-[4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]-N-phenylacetamide (PubChem CID 126301338) has the molecular formula C32H23N5O7 and a molecular weight of 589.56 g/mol. Its IUPAC name is 2-[4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126301338 |
| Molecular Formula | C32H23N5O7 |
| Molecular Weight | 589.56 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | 2-[4-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]-N-phenylacetamide |
| SMILES | COc1cccc2oc(-c3nc4ccccc4c(=O)n3N=Cc3ccc(OCC(=O)Nc4ccccc4)c([N+](=O)[O-])c3)cc12 |
| InChI | InChI=1S/C32H23N5O7/c1-42-26-12-7-13-27-23(26)17-29(44-27)31-35-24-11-6-5-10-22(24)32(39)36(31)33-18-20-14-15-28(25(16-20)37(40)41)43-19-30(38)34-21-8-3-2-4-9-21/h2-18H,19H2,1H3,(H,34,38) |
| InChIKey | DGIBVGBCAZDXBR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 151.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|