C30H28IN3O5 — CID 126303907
3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-iodophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126303907) has the molecular formula C30H28IN3O5 and a molecular weight of 637.47 g/mol. Its IUPAC name is 3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-iodophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-iodophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126303907 |
| Molecular Formula | C30H28IN3O5 |
| Molecular Weight | 637.47 g/mol |
| Exact Mass | 637.11 |
| IUPAC Name | 3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-iodophenyl]methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)cc(I)c1O[C@H](C)CC |
| InChI | InChI=1S/C30H28IN3O5/c1-5-18(3)38-28-22(31)14-19(15-26(28)37-6-2)17-32-34-29(33-23-11-8-7-10-20(23)30(34)35)27-16-21-24(36-4)12-9-13-25(21)39-27/h7-18H,5-6H2,1-4H3/t18-/m1/s1 |
| InChIKey | LANITLHWORWFHU-GOSISDBHSA-N |
| XLogP | 6.88 |
| TPSA | 88.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.47 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|