C27H21BrN4O5 — CID 126307441
2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(2S)-butan-2-yl]oxy-3-nitrophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126307441) has the molecular formula C27H21BrN4O5 and a molecular weight of 561.39 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(2S)-butan-2-yl]oxy-3-nitrophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(2S)-butan-2-yl]oxy-3-nitrophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126307441 |
| Molecular Formula | C27H21BrN4O5 |
| Molecular Weight | 561.39 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(2S)-butan-2-yl]oxy-3-nitrophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)Oc1ccc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H21BrN4O5/c1-3-16(2)36-24-10-8-17(12-22(24)32(34)35)15-29-31-26(30-21-7-5-4-6-20(21)27(31)33)25-14-18-13-19(28)9-11-23(18)37-25/h4-16H,3H2,1-2H3/t16-/m0/s1 |
| InChIKey | BZQIMSZSORADBY-INIZCTEOSA-N |
| XLogP | 6.54 |
| TPSA | 112.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.39 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|