C27H21BrIN3O3 — CID 126313124
2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(2R)-butan-2-yl]oxy-3-iodophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126313124) has the molecular formula C27H21BrIN3O3 and a molecular weight of 642.29 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(2R)-butan-2-yl]oxy-3-iodophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(2R)-butan-2-yl]oxy-3-iodophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126313124 |
| Molecular Formula | C27H21BrIN3O3 |
| Molecular Weight | 642.29 g/mol |
| Exact Mass | 640.98 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(2R)-butan-2-yl]oxy-3-iodophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)Oc1ccc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)cc1I |
| InChI | InChI=1S/C27H21BrIN3O3/c1-3-16(2)34-24-10-8-17(12-21(24)29)15-30-32-26(31-22-7-5-4-6-20(22)27(32)33)25-14-18-13-19(28)9-11-23(18)35-25/h4-16H,3H2,1-2H3/t16-/m1/s1 |
| InChIKey | QPAJIQSQDIQQJS-MRXNPFEDSA-N |
| XLogP | 7.24 |
| TPSA | 69.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.29 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|