C29H25BrN4O6 — CID 126286781
2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-nitrophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126286781) has the molecular formula C29H25BrN4O6 and a molecular weight of 605.45 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-nitrophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-nitrophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126286781 |
| Molecular Formula | C29H25BrN4O6 |
| Molecular Weight | 605.45 g/mol |
| Exact Mass | 604.10 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)-3-[[4-[(2R)-butan-2-yl]oxy-3-ethoxy-5-nitrophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4cc(Br)ccc4o3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1O[C@H](C)CC |
| InChI | InChI=1S/C29H25BrN4O6/c1-4-17(3)39-27-23(34(36)37)12-18(13-25(27)38-5-2)16-31-33-28(32-22-9-7-6-8-21(22)29(33)35)26-15-19-14-20(30)10-11-24(19)40-26/h6-17H,4-5H2,1-3H3/t17-/m1/s1 |
| InChIKey | KQPAJMFHOPZOPM-QGZVFWFLSA-N |
| XLogP | 6.94 |
| TPSA | 121.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.45 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|