C28H19N3O4 — CID 137068181
3-[(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 137068181) has the molecular formula C28H19N3O4 and a molecular weight of 461.48 g/mol. Its IUPAC name is 3-[(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 137068181 |
| Molecular Formula | C28H19N3O4 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 3-[(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | COc1cccc2oc(-c3nc4ccccc4c(=O)n3N=Cc3c(O)ccc4ccccc34)cc12 |
| InChI | InChI=1S/C28H19N3O4/c1-34-24-11-6-12-25-20(24)15-26(35-25)27-30-22-10-5-4-9-19(22)28(33)31(27)29-16-21-18-8-3-2-7-17(18)13-14-23(21)32/h2-16,32H,1H3 |
| InChIKey | SLUYIDVRQRPXCS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|