C30H24N4O3 — CID 126314881
2-(4-methoxy-1-benzofuran-2-yl)-3-[(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]quinazolin-4-one (PubChem CID 126314881) has the molecular formula C30H24N4O3 and a molecular weight of 488.55 g/mol. Its IUPAC name is 2-(4-methoxy-1-benzofuran-2-yl)-3-[(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(4-methoxy-1-benzofuran-2-yl)-3-[(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126314881 |
| Molecular Formula | C30H24N4O3 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2-(4-methoxy-1-benzofuran-2-yl)-3-[(2-methyl-1-prop-2-enylindol-3-yl)methylideneamino]quinazolin-4-one |
| SMILES | C=CCn1c(C)c(C=Nn2c(-c3cc4c(OC)cccc4o3)nc3ccccc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C30H24N4O3/c1-4-16-33-19(2)23(20-10-6-8-13-25(20)33)18-31-34-29(32-24-12-7-5-11-21(24)30(34)35)28-17-22-26(36-3)14-9-15-27(22)37-28/h4-15,17-18H,1,16H2,2-3H3 |
| InChIKey | YNOOVKGUDBDIQL-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 74.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|