C22H13BrIN3O4 — CID 126300887
3-[(4-bromo-5-iodofuran-2-yl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126300887) has the molecular formula C22H13BrIN3O4 and a molecular weight of 590.17 g/mol. Its IUPAC name is 3-[(4-bromo-5-iodofuran-2-yl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[(4-bromo-5-iodofuran-2-yl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126300887 |
| Molecular Formula | C22H13BrIN3O4 |
| Molecular Weight | 590.17 g/mol |
| Exact Mass | 588.91 |
| IUPAC Name | 3-[(4-bromo-5-iodofuran-2-yl)methylideneamino]-2-(4-methoxy-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | COc1cccc2oc(-c3nc4ccccc4c(=O)n3N=Cc3cc(Br)c(I)o3)cc12 |
| InChI | InChI=1S/C22H13BrIN3O4/c1-29-17-7-4-8-18-14(17)10-19(31-18)21-26-16-6-3-2-5-13(16)22(28)27(21)25-11-12-9-15(23)20(24)30-12/h2-11H,1H3 |
| InChIKey | PAAMIJOPAQXNQZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 82.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.17 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|