C29H18N4O4 — CID 126303834
4-[5-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]benzonitrile (PubChem CID 126303834) has the molecular formula C29H18N4O4 and a molecular weight of 486.49 g/mol. Its IUPAC name is 4-[5-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]benzonitrile.
| Compound Name | 4-[5-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 126303834 |
| Molecular Formula | C29H18N4O4 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 4-[5-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]benzonitrile |
| SMILES | COc1cccc2oc(-c3nc4ccccc4c(=O)n3N=Cc3ccc(-c4ccc(C#N)cc4)o3)cc12 |
| InChI | InChI=1S/C29H18N4O4/c1-35-25-7-4-8-26-22(25)15-27(37-26)28-32-23-6-3-2-5-21(23)29(34)33(28)31-17-20-13-14-24(36-20)19-11-9-18(16-30)10-12-19/h2-15,17H,1H3 |
| InChIKey | UWMDVZFGQDPWGE-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 106.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|