C30H20ClN3O6 — CID 126294953
methyl 4-chloro-3-[5-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]benzoate (PubChem CID 126294953) has the molecular formula C30H20ClN3O6 and a molecular weight of 553.96 g/mol. Its IUPAC name is methyl 4-chloro-3-[5-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-chloro-3-[5-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126294953 |
| Molecular Formula | C30H20ClN3O6 |
| Molecular Weight | 553.96 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | methyl 4-chloro-3-[5-[[2-(4-methoxy-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(-c2ccc(C=Nn3c(-c4cc5c(OC)cccc5o4)nc4ccccc4c3=O)o2)c1 |
| InChI | InChI=1S/C30H20ClN3O6/c1-37-24-8-5-9-25-21(24)15-27(40-25)28-33-23-7-4-3-6-19(23)29(35)34(28)32-16-18-11-13-26(39-18)20-14-17(30(36)38-2)10-12-22(20)31/h3-16H,1-2H3 |
| InChIKey | JHJBUSXDMDNXSE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 109.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.96 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|