C34H24ClN5O3 — CID 126300173
2-[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 126300173) has the molecular formula C34H24ClN5O3 and a molecular weight of 586.05 g/mol. Its IUPAC name is 2-[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126300173 |
| Molecular Formula | C34H24ClN5O3 |
| Molecular Weight | 586.05 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | 2-[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]indol-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2cc(C=Nn3c(-c4cc5cc(Cl)ccc5o4)nc4ccccc4c3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C34H24ClN5O3/c1-21-10-13-25(14-11-21)37-32(41)20-39-19-23(26-6-3-5-9-29(26)39)18-36-40-33(38-28-8-4-2-7-27(28)34(40)42)31-17-22-16-24(35)12-15-30(22)43-31/h2-19H,20H2,1H3,(H,37,41) |
| InChIKey | MZBLWCBEQZDNGI-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.05 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|