C21H11BrClN3O2S — CID 126287660
3-[(4-bromothiophen-2-yl)methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126287660) has the molecular formula C21H11BrClN3O2S and a molecular weight of 484.76 g/mol. Its IUPAC name is 3-[(4-bromothiophen-2-yl)methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[(4-bromothiophen-2-yl)methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126287660 |
| Molecular Formula | C21H11BrClN3O2S |
| Molecular Weight | 484.76 g/mol |
| Exact Mass | 482.94 |
| IUPAC Name | 3-[(4-bromothiophen-2-yl)methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3cc(Cl)ccc3o2)n1N=Cc1cc(Br)cs1 |
| InChI | InChI=1S/C21H11BrClN3O2S/c22-13-9-15(29-11-13)10-24-26-20(25-17-4-2-1-3-16(17)21(26)27)19-8-12-7-14(23)5-6-18(12)28-19/h1-11H |
| InChIKey | MPYWGFRWFFLJRY-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.76 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|