C25H16ClN3O4 — CID 126289730
2-(5-chloro-1-benzofuran-2-yl)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)quinazolin-4-one (PubChem CID 126289730) has the molecular formula C25H16ClN3O4 and a molecular weight of 457.87 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)quinazolin-4-one |
|---|---|
| PubChem CID | 126289730 |
| Molecular Formula | C25H16ClN3O4 |
| Molecular Weight | 457.87 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3cc(Cl)ccc3o2)n1N=Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H16ClN3O4/c26-17-6-8-20-16(12-17)13-23(33-20)24-28-19-4-2-1-3-18(19)25(30)29(24)27-14-15-5-7-21-22(11-15)32-10-9-31-21/h1-8,11-14H,9-10H2 |
| InChIKey | QZNZUKKDZZCGAG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 78.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.87 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|