C23H13BrClN3O3 — CID 137036436
3-[(3-bromo-4-hydroxyphenyl)methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 137036436) has the molecular formula C23H13BrClN3O3 and a molecular weight of 494.73 g/mol. Its IUPAC name is 3-[(3-bromo-4-hydroxyphenyl)methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[(3-bromo-4-hydroxyphenyl)methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 137036436 |
| Molecular Formula | C23H13BrClN3O3 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 492.98 |
| IUPAC Name | 3-[(3-bromo-4-hydroxyphenyl)methylideneamino]-2-(5-chloro-1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3cc(Cl)ccc3o2)n1N=Cc1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C23H13BrClN3O3/c24-17-9-13(5-7-19(17)29)12-26-28-22(27-18-4-2-1-3-16(18)23(28)30)21-11-14-10-15(25)6-8-20(14)31-21/h1-12,29H |
| InChIKey | IHCSJRAOLXUHTD-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|