C24H13ClF3N3O2 — CID 126288260
2-(5-chloro-1-benzofuran-2-yl)-3-[[2-(trifluoromethyl)phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126288260) has the molecular formula C24H13ClF3N3O2 and a molecular weight of 467.83 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[[2-(trifluoromethyl)phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[2-(trifluoromethyl)phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126288260 |
| Molecular Formula | C24H13ClF3N3O2 |
| Molecular Weight | 467.83 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[2-(trifluoromethyl)phenyl]methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3cc(Cl)ccc3o2)n1N=Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H13ClF3N3O2/c25-16-9-10-20-15(11-16)12-21(33-20)22-30-19-8-4-2-6-17(19)23(32)31(22)29-13-14-5-1-3-7-18(14)24(26,27)28/h1-13H |
| InChIKey | NXEJXZPHHLXTLF-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.83 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|