C28H24N4O5 — CID 126305840
2-(1-benzofuran-2-yl)-3-[[2-(2,2-dimethylpropoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126305840) has the molecular formula C28H24N4O5 and a molecular weight of 496.52 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[2-(2,2-dimethylpropoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[2-(2,2-dimethylpropoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126305840 |
| Molecular Formula | C28H24N4O5 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[2-(2,2-dimethylpropoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC(C)(C)COc1ccc([N+](=O)[O-])cc1C=Nn1c(-c2cc3ccccc3o2)nc2ccccc2c1=O |
| InChI | InChI=1S/C28H24N4O5/c1-28(2,3)17-36-23-13-12-20(32(34)35)14-19(23)16-29-31-26(25-15-18-8-4-7-11-24(18)37-25)30-22-10-6-5-9-21(22)27(31)33/h4-16H,17H2,1-3H3 |
| InChIKey | RMJAJHQEUWTZIJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 112.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|