C23H24BrI2N3O2 — CID 126302328
6-bromo-3-[[4-[(2R)-butan-2-yl]oxy-3,5-diiodophenyl]methylideneamino]-2-tert-butylquinazolin-4-one (PubChem CID 126302328) has the molecular formula C23H24BrI2N3O2 and a molecular weight of 708.18 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(2R)-butan-2-yl]oxy-3,5-diiodophenyl]methylideneamino]-2-tert-butylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(2R)-butan-2-yl]oxy-3,5-diiodophenyl]methylideneamino]-2-tert-butylquinazolin-4-one |
|---|---|
| PubChem CID | 126302328 |
| Molecular Formula | C23H24BrI2N3O2 |
| Molecular Weight | 708.18 g/mol |
| Exact Mass | 706.91 |
| IUPAC Name | 6-bromo-3-[[4-[(2R)-butan-2-yl]oxy-3,5-diiodophenyl]methylideneamino]-2-tert-butylquinazolin-4-one |
| SMILES | CC[C@@H](C)Oc1c(I)cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)cc1I |
| InChI | InChI=1S/C23H24BrI2N3O2/c1-6-13(2)31-20-17(25)9-14(10-18(20)26)12-27-29-21(30)16-11-15(24)7-8-19(16)28-22(29)23(3,4)5/h7-13H,6H2,1-5H3/t13-/m1/s1 |
| InChIKey | PWXKRDWIGHYECR-CYBMUJFWSA-N |
| XLogP | 6.73 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.18 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|