C27H32BrN3O3 — CID 126300234
6-bromo-3-[[4-[(2R)-butan-2-yl]oxy-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-tert-butylquinazolin-4-one (PubChem CID 126300234) has the molecular formula C27H32BrN3O3 and a molecular weight of 526.48 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(2R)-butan-2-yl]oxy-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-tert-butylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(2R)-butan-2-yl]oxy-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-tert-butylquinazolin-4-one |
|---|---|
| PubChem CID | 126300234 |
| Molecular Formula | C27H32BrN3O3 |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 6-bromo-3-[[4-[(2R)-butan-2-yl]oxy-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-2-tert-butylquinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)cc(OC)c1O[C@H](C)CC |
| InChI | InChI=1S/C27H32BrN3O3/c1-8-10-19-13-18(14-23(33-7)24(19)34-17(3)9-2)16-29-31-25(32)21-15-20(28)11-12-22(21)30-26(31)27(4,5)6/h8,11-17H,1,9-10H2,2-7H3/t17-/m1/s1 |
| InChIKey | NJLOSDWZFATTMY-QGZVFWFLSA-N |
| XLogP | 6.25 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|