C25H26BrN3O4 — CID 126305715
[4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenyl] acetate (PubChem CID 126305715) has the molecular formula C25H26BrN3O4 and a molecular weight of 512.40 g/mol. Its IUPAC name is [4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenyl] acetate.
| Compound Name | [4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenyl] acetate |
|---|---|
| PubChem CID | 126305715 |
| Molecular Formula | C25H26BrN3O4 |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | [4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methoxy-6-prop-2-enylphenyl] acetate |
| SMILES | C=CCc1cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C25H26BrN3O4/c1-7-8-17-11-16(12-21(32-6)22(17)33-15(2)30)14-27-29-23(31)19-13-18(26)9-10-20(19)28-24(29)25(3,4)5/h7,9-14H,1,8H2,2-6H3 |
| InChIKey | UEDZCVUDXJIWON-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|