C22H20Br3N3O4 — CID 126286451
[2,3-dibromo-4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenyl] acetate (PubChem CID 126286451) has the molecular formula C22H20Br3N3O4 and a molecular weight of 630.13 g/mol. Its IUPAC name is [2,3-dibromo-4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenyl] acetate.
| Compound Name | [2,3-dibromo-4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 126286451 |
| Molecular Formula | C22H20Br3N3O4 |
| Molecular Weight | 630.13 g/mol |
| Exact Mass | 626.90 |
| IUPAC Name | [2,3-dibromo-4-[(6-bromo-2-tert-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-methoxyphenyl] acetate |
| SMILES | COc1cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)c(Br)c(Br)c1OC(C)=O |
| InChI | InChI=1S/C22H20Br3N3O4/c1-11(29)32-19-16(31-5)8-12(17(24)18(19)25)10-26-28-20(30)14-9-13(23)6-7-15(14)27-21(28)22(2,3)4/h6-10H,1-5H3 |
| InChIKey | KSAIPGYNGLNYCZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.13 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|