C25H30BrN3O3 — CID 126310696
6-bromo-2-tert-butyl-3-[[2-(2,2-dimethylpropoxy)-3-methoxyphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126310696) has the molecular formula C25H30BrN3O3 and a molecular weight of 500.44 g/mol. Its IUPAC name is 6-bromo-2-tert-butyl-3-[[2-(2,2-dimethylpropoxy)-3-methoxyphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-tert-butyl-3-[[2-(2,2-dimethylpropoxy)-3-methoxyphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126310696 |
| Molecular Formula | C25H30BrN3O3 |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 6-bromo-2-tert-butyl-3-[[2-(2,2-dimethylpropoxy)-3-methoxyphenyl]methylideneamino]quinazolin-4-one |
| SMILES | COc1cccc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)c1OCC(C)(C)C |
| InChI | InChI=1S/C25H30BrN3O3/c1-24(2,3)15-32-21-16(9-8-10-20(21)31-7)14-27-29-22(30)18-13-17(26)11-12-19(18)28-23(29)25(4,5)6/h8-14H,15H2,1-7H3 |
| InChIKey | KDQNACBMDXBBGG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|