C22H23BrClN3O3 — CID 126293790
6-bromo-2-tert-butyl-3-[(5-chloro-2-ethoxy-3-methoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126293790) has the molecular formula C22H23BrClN3O3 and a molecular weight of 492.80 g/mol. Its IUPAC name is 6-bromo-2-tert-butyl-3-[(5-chloro-2-ethoxy-3-methoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-tert-butyl-3-[(5-chloro-2-ethoxy-3-methoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126293790 |
| Molecular Formula | C22H23BrClN3O3 |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 6-bromo-2-tert-butyl-3-[(5-chloro-2-ethoxy-3-methoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCOc1c(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)cc(Cl)cc1OC |
| InChI | InChI=1S/C22H23BrClN3O3/c1-6-30-19-13(9-15(24)11-18(19)29-5)12-25-27-20(28)16-10-14(23)7-8-17(16)26-21(27)22(2,3)4/h7-12H,6H2,1-5H3 |
| InChIKey | XLGWVOBVOANEHA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|